![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Academic Council Meeting_2021-22.pdf | 2022-12-19 08:59 | 280K | |
| BCREC Service Rule.pdf | 2022-12-19 08:59 | 4.3M | |
| BOG_2021-22.pdf | 2022-12-19 08:59 | 839K | |
| DAC_2021-22.pdf | 2022-12-16 10:34 | 13M | |
| DAC_MINUTES_CE/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_CSE/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_ECE/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_EE/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_IT/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_MBA/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_MCA/ | 2024-06-25 15:56 | - | |
| DAC_MINUTES_ME/ | 2024-06-25 15:56 | - | |
| Flow Chart - Org. structure 2021-22.pdf | 2022-12-19 08:59 | 97K | |
| IQAC_2021-22.pdf | 2022-12-19 08:59 | 15M | |
| Job responsibilities of Academic Staff & Administrative Staff.pdf | 2022-12-19 08:59 | 323K | |
| Roles and Responsibilities of various Committees of the Institute.pdf | 2022-12-19 08:59 | 263K | |
| Student_Council_2021-22.pdf | 2022-12-19 08:59 | 512K | |